C12H15N3O4S2 — CID 104934694
(2S)-2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)hexanoic acid (PubChem CID 104934694) has the molecular formula C12H15N3O4S2 and a molecular weight of 329.40 g/mol. Its IUPAC name is (2S)-2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)hexanoic acid.
| Compound Name | (2S)-2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)hexanoic acid |
|---|---|
| PubChem CID | 104934694 |
| Molecular Formula | C12H15N3O4S2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | (2S)-2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)hexanoic acid |
| SMILES | CCCC[C@H](NS(=O)(=O)c1cccc2nsnc12)C(=O)O |
| InChI | InChI=1S/C12H15N3O4S2/c1-2-3-5-9(12(16)17)15-21(18,19)10-7-4-6-8-11(10)14-20-13-8/h4,6-7,9,15H,2-3,5H2,1H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | YCZYCZZEBRAEJM-VIFPVBQESA-N |
| XLogP | 1.61 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |