C10H13N3O2S2 — CID 3377484
N-butyl-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 3377484) has the molecular formula C10H13N3O2S2 and a molecular weight of 271.37 g/mol. Its IUPAC name is N-butyl-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-butyl-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 3377484 |
| Molecular Formula | C10H13N3O2S2 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | N-butyl-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | CCCCNS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C10H13N3O2S2/c1-2-3-7-11-17(14,15)9-6-4-5-8-10(9)13-16-12-8/h4-6,11H,2-3,7H2,1H3 |
| InChIKey | BAOJDRGKFMZLCJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|