C10H12ClN3O2S2 — CID 65033045
N-(3-chlorobutyl)-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 65033045) has the molecular formula C10H12ClN3O2S2 and a molecular weight of 305.81 g/mol. Its IUPAC name is N-(3-chlorobutyl)-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-(3-chlorobutyl)-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 65033045 |
| Molecular Formula | C10H12ClN3O2S2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | N-(3-chlorobutyl)-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | CC(Cl)CCNS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C10H12ClN3O2S2/c1-7(11)5-6-12-18(15,16)9-4-2-3-8-10(9)14-17-13-8/h2-4,7,12H,5-6H2,1H3 |
| InChIKey | LRVZDTUORVIPOU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|