C13H15ClN2O2S — CID 113451724
N-(3-chlorobutyl)quinoline-5-sulfonamide (PubChem CID 113451724) has the molecular formula C13H15ClN2O2S and a molecular weight of 298.79 g/mol. Its IUPAC name is N-(3-chlorobutyl)quinoline-5-sulfonamide.
| Compound Name | N-(3-chlorobutyl)quinoline-5-sulfonamide |
|---|---|
| PubChem CID | 113451724 |
| Molecular Formula | C13H15ClN2O2S |
| Molecular Weight | 298.79 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | N-(3-chlorobutyl)quinoline-5-sulfonamide |
| SMILES | CC(Cl)CCNS(=O)(=O)c1cccc2ncccc12 |
| InChI | InChI=1S/C13H15ClN2O2S/c1-10(14)7-9-16-19(17,18)13-6-2-5-12-11(13)4-3-8-15-12/h2-6,8,10,16H,7,9H2,1H3 |
| InChIKey | SROUDQOBVGUIBF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.79 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|