C12H14N2O4S — CID 115755300
N-(1,3-dihydroxypropan-2-yl)quinoline-5-sulfonamide (PubChem CID 115755300) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)quinoline-5-sulfonamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)quinoline-5-sulfonamide |
|---|---|
| PubChem CID | 115755300 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)quinoline-5-sulfonamide |
| SMILES | O=S(=O)(NC(CO)CO)c1cccc2ncccc12 |
| InChI | InChI=1S/C12H14N2O4S/c15-7-9(8-16)14-19(17,18)12-5-1-4-11-10(12)3-2-6-13-11/h1-6,9,14-16H,7-8H2 |
| InChIKey | KHBCXWPGCAHBHF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |