C13H14N2O5S — CID 104933783
(2R)-4-hydroxy-2-(quinolin-5-ylsulfonylamino)butanoic acid (PubChem CID 104933783) has the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. Its IUPAC name is (2R)-4-hydroxy-2-(quinolin-5-ylsulfonylamino)butanoic acid.
| Compound Name | (2R)-4-hydroxy-2-(quinolin-5-ylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 104933783 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | (2R)-4-hydroxy-2-(quinolin-5-ylsulfonylamino)butanoic acid |
| SMILES | O=C(O)[C@@H](CCO)NS(=O)(=O)c1cccc2ncccc12 |
| InChI | InChI=1S/C13H14N2O5S/c16-8-6-11(13(17)18)15-21(19,20)12-5-1-4-10-9(12)3-2-7-14-10/h1-5,7,11,15-16H,6,8H2,(H,17,18)/t11-/m1/s1 |
| InChIKey | MYHYDDQKDJSYSA-LLVKDONJSA-N |
| XLogP | 0.35 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |