C9H9N3O2S2 — CID 3109773
N-prop-2-enyl-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 3109773) has the molecular formula C9H9N3O2S2 and a molecular weight of 255.32 g/mol. Its IUPAC name is N-prop-2-enyl-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-prop-2-enyl-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 3109773 |
| Molecular Formula | C9H9N3O2S2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | N-prop-2-enyl-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | C=CCNS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C9H9N3O2S2/c1-2-6-10-16(13,14)8-5-3-4-7-9(8)12-15-11-7/h2-5,10H,1,6H2 |
| InChIKey | KRRPWAYKZSRPKG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|