C13H10BrN3O2S2 — CID 61413865
N-[(2-bromophenyl)methyl]-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 61413865) has the molecular formula C13H10BrN3O2S2 and a molecular weight of 384.28 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-[(2-bromophenyl)methyl]-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 61413865 |
| Molecular Formula | C13H10BrN3O2S2 |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 382.94 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | O=S(=O)(NCc1ccccc1Br)c1cccc2nsnc12 |
| InChI | InChI=1S/C13H10BrN3O2S2/c14-10-5-2-1-4-9(10)8-15-21(18,19)12-7-3-6-11-13(12)17-20-16-11/h1-7,15H,8H2 |
| InChIKey | USMGSJXICHMLFZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |