C17H19N3O4S2 — CID 22206227
N-[(3,4-diethoxyphenyl)methyl]-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 22206227) has the molecular formula C17H19N3O4S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-[(3,4-diethoxyphenyl)methyl]-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-[(3,4-diethoxyphenyl)methyl]-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 22206227 |
| Molecular Formula | C17H19N3O4S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N-[(3,4-diethoxyphenyl)methyl]-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | CCOc1ccc(CNS(=O)(=O)c2cccc3nsnc23)cc1OCC |
| InChI | InChI=1S/C17H19N3O4S2/c1-3-23-14-9-8-12(10-15(14)24-4-2)11-18-26(21,22)16-7-5-6-13-17(16)20-25-19-13/h5-10,18H,3-4,11H2,1-2H3 |
| InChIKey | BBSWWKAYVHJRPW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |