C15H15N3O5S — CID 22203272
N-[(3,4-dimethoxyphenyl)methyl]-2,1,3-benzoxadiazole-4-sulfonamide (PubChem CID 22203272) has the molecular formula C15H15N3O5S and a molecular weight of 349.37 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2,1,3-benzoxadiazole-4-sulfonamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2,1,3-benzoxadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 22203272 |
| Molecular Formula | C15H15N3O5S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2,1,3-benzoxadiazole-4-sulfonamide |
| SMILES | COc1ccc(CNS(=O)(=O)c2cccc3nonc23)cc1OC |
| InChI | InChI=1S/C15H15N3O5S/c1-21-12-7-6-10(8-13(12)22-2)9-16-24(19,20)14-5-3-4-11-15(14)18-23-17-11/h3-8,16H,9H2,1-2H3 |
| InChIKey | GGFTYLGKMGUGDF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |