C17H20ClNO5S — CID 167951708
3-chloro-2-hydroxy-N-[(3-methoxy-4-propoxyphenyl)methyl]benzenesulfonamide (PubChem CID 167951708) has the molecular formula C17H20ClNO5S and a molecular weight of 385.87 g/mol. Its IUPAC name is 3-chloro-2-hydroxy-N-[(3-methoxy-4-propoxyphenyl)methyl]benzenesulfonamide.
| Compound Name | 3-chloro-2-hydroxy-N-[(3-methoxy-4-propoxyphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 167951708 |
| Molecular Formula | C17H20ClNO5S |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 3-chloro-2-hydroxy-N-[(3-methoxy-4-propoxyphenyl)methyl]benzenesulfonamide |
| SMILES | CCCOc1ccc(CNS(=O)(=O)c2cccc(Cl)c2O)cc1OC |
| InChI | InChI=1S/C17H20ClNO5S/c1-3-9-24-14-8-7-12(10-15(14)23-2)11-19-25(21,22)16-6-4-5-13(18)17(16)20/h4-8,10,19-20H,3,9,11H2,1-2H3 |
| InChIKey | IJRHWGWGMAECGE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |