C21H18Cl4N2O5S2 — CID 141131546
1-N,3-N-bis[(3,4-dichlorophenyl)methyl]-4-methoxybenzene-1,3-disulfonamide (PubChem CID 141131546) has the molecular formula C21H18Cl4N2O5S2 and a molecular weight of 584.33 g/mol. Its IUPAC name is 1-N,3-N-bis[(3,4-dichlorophenyl)methyl]-4-methoxybenzene-1,3-disulfonamide.
| Compound Name | 1-N,3-N-bis[(3,4-dichlorophenyl)methyl]-4-methoxybenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 141131546 |
| Molecular Formula | C21H18Cl4N2O5S2 |
| Molecular Weight | 584.33 g/mol |
| Exact Mass | 581.94 |
| IUPAC Name | 1-N,3-N-bis[(3,4-dichlorophenyl)methyl]-4-methoxybenzene-1,3-disulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2ccc(Cl)c(Cl)c2)cc1S(=O)(=O)NCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H18Cl4N2O5S2/c1-32-20-7-4-15(33(28,29)26-11-13-2-5-16(22)18(24)8-13)10-21(20)34(30,31)27-12-14-3-6-17(23)19(25)9-14/h2-10,26-27H,11-12H2,1H3 |
| InChIKey | GIUQAEKRTKDBJK-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.33 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |