C15H17ClN2O3S — CID 141351209
5-(aminomethyl)-N-[(4-chlorophenyl)methyl]-2-methoxybenzenesulfonamide (PubChem CID 141351209) has the molecular formula C15H17ClN2O3S and a molecular weight of 340.83 g/mol. Its IUPAC name is 5-(aminomethyl)-N-[(4-chlorophenyl)methyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-(aminomethyl)-N-[(4-chlorophenyl)methyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 141351209 |
| Molecular Formula | C15H17ClN2O3S |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 5-(aminomethyl)-N-[(4-chlorophenyl)methyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(CN)cc1S(=O)(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H17ClN2O3S/c1-21-14-7-4-12(9-17)8-15(14)22(19,20)18-10-11-2-5-13(16)6-3-11/h2-8,18H,9-10,17H2,1H3 |
| InChIKey | AJPJJTVCGOLMQQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |