C18H16ClNO4S — CID 119103357
5-chloro-N-[[4-(furan-3-yl)phenyl]methyl]-2-methoxybenzenesulfonamide (PubChem CID 119103357) has the molecular formula C18H16ClNO4S and a molecular weight of 377.85 g/mol. Its IUPAC name is 5-chloro-N-[[4-(furan-3-yl)phenyl]methyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-chloro-N-[[4-(furan-3-yl)phenyl]methyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 119103357 |
| Molecular Formula | C18H16ClNO4S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 5-chloro-N-[[4-(furan-3-yl)phenyl]methyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)NCc1ccc(-c2ccoc2)cc1 |
| InChI | InChI=1S/C18H16ClNO4S/c1-23-17-7-6-16(19)10-18(17)25(21,22)20-11-13-2-4-14(5-3-13)15-8-9-24-12-15/h2-10,12,20H,11H2,1H3 |
| InChIKey | YWOVFRWABONTOR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |