C13H14ClNO5S — CID 71798368
5-chloro-N-[2-(furan-3-yl)-2-hydroxyethyl]-2-methoxybenzenesulfonamide (PubChem CID 71798368) has the molecular formula C13H14ClNO5S and a molecular weight of 331.78 g/mol. Its IUPAC name is 5-chloro-N-[2-(furan-3-yl)-2-hydroxyethyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-chloro-N-[2-(furan-3-yl)-2-hydroxyethyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 71798368 |
| Molecular Formula | C13H14ClNO5S |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 5-chloro-N-[2-(furan-3-yl)-2-hydroxyethyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)NCC(O)c1ccoc1 |
| InChI | InChI=1S/C13H14ClNO5S/c1-19-12-3-2-10(14)6-13(12)21(17,18)15-7-11(16)9-4-5-20-8-9/h2-6,8,11,15-16H,7H2,1H3 |
| InChIKey | GCVFDJAGAJNDHY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |