C12H16ClNO5S — CID 3853421
propan-2-yl 2-[(5-chloro-2-methoxyphenyl)sulfonylamino]acetate (PubChem CID 3853421) has the molecular formula C12H16ClNO5S and a molecular weight of 321.78 g/mol. Its IUPAC name is propan-2-yl 2-[(5-chloro-2-methoxyphenyl)sulfonylamino]acetate.
| Compound Name | propan-2-yl 2-[(5-chloro-2-methoxyphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 3853421 |
| Molecular Formula | C12H16ClNO5S |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | propan-2-yl 2-[(5-chloro-2-methoxyphenyl)sulfonylamino]acetate |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)NCC(=O)OC(C)C |
| InChI | InChI=1S/C12H16ClNO5S/c1-8(2)19-12(15)7-14-20(16,17)11-6-9(13)4-5-10(11)18-3/h4-6,8,14H,7H2,1-3H3 |
| InChIKey | PFJQOEADBGWJCO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |