C21H25ClN2O6S — CID 55306794
[2-(diethylamino)-2-oxoethyl] 3-[(4-chlorophenyl)methylsulfamoyl]-4-methoxybenzoate (PubChem CID 55306794) has the molecular formula C21H25ClN2O6S and a molecular weight of 468.96 g/mol. Its IUPAC name is [2-(diethylamino)-2-oxoethyl] 3-[(4-chlorophenyl)methylsulfamoyl]-4-methoxybenzoate.
| Compound Name | [2-(diethylamino)-2-oxoethyl] 3-[(4-chlorophenyl)methylsulfamoyl]-4-methoxybenzoate |
|---|---|
| PubChem CID | 55306794 |
| Molecular Formula | C21H25ClN2O6S |
| Molecular Weight | 468.96 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | [2-(diethylamino)-2-oxoethyl] 3-[(4-chlorophenyl)methylsulfamoyl]-4-methoxybenzoate |
| SMILES | CCN(CC)C(=O)COC(=O)c1ccc(OC)c(S(=O)(=O)NCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H25ClN2O6S/c1-4-24(5-2)20(25)14-30-21(26)16-8-11-18(29-3)19(12-16)31(27,28)23-13-15-6-9-17(22)10-7-15/h6-12,23H,4-5,13-14H2,1-3H3 |
| InChIKey | IXWANXLJEFOZMA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.96 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |