C17H22N2O6S — CID 7974292
[2-[bis(prop-2-enyl)amino]-2-oxoethyl] 4-methoxy-3-(methylsulfamoyl)benzoate (PubChem CID 7974292) has the molecular formula C17H22N2O6S and a molecular weight of 382.44 g/mol. Its IUPAC name is [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 4-methoxy-3-(methylsulfamoyl)benzoate.
| Compound Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 4-methoxy-3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7974292 |
| Molecular Formula | C17H22N2O6S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 4-methoxy-3-(methylsulfamoyl)benzoate |
| SMILES | C=CCN(CC=C)C(=O)COC(=O)c1ccc(OC)c(S(=O)(=O)NC)c1 |
| InChI | InChI=1S/C17H22N2O6S/c1-5-9-19(10-6-2)16(20)12-25-17(21)13-7-8-14(24-4)15(11-13)26(22,23)18-3/h5-8,11,18H,1-2,9-10,12H2,3-4H3 |
| InChIKey | HJMJDETUYPTCBV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|