C25H28N2O7 — CID 25441341
[2-[bis(prop-2-enyl)amino]-2-oxoethyl] 3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoate (PubChem CID 25441341) has the molecular formula C25H28N2O7 and a molecular weight of 468.51 g/mol. Its IUPAC name is [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoate.
| Compound Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 25441341 |
| Molecular Formula | C25H28N2O7 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoate |
| SMILES | C=CCN(CC=C)C(=O)COC(=O)c1ccc(OCC(=O)Nc2ccccc2OC)c(OC)c1 |
| InChI | InChI=1S/C25H28N2O7/c1-5-13-27(14-6-2)24(29)17-34-25(30)18-11-12-21(22(15-18)32-4)33-16-23(28)26-19-9-7-8-10-20(19)31-3/h5-12,15H,1-2,13-14,16-17H2,3-4H3,(H,26,28) |
| InChIKey | PZUGXBHVJDUJPJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|