C25H24ClNO7 — CID 42965688
2-(4-chlorophenoxy)ethyl 3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoate (PubChem CID 42965688) has the molecular formula C25H24ClNO7 and a molecular weight of 485.92 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)ethyl 3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoate.
| Compound Name | 2-(4-chlorophenoxy)ethyl 3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 42965688 |
| Molecular Formula | C25H24ClNO7 |
| Molecular Weight | 485.92 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 2-(4-chlorophenoxy)ethyl 3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoate |
| SMILES | COc1ccccc1NC(=O)COc1ccc(C(=O)OCCOc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C25H24ClNO7/c1-30-21-6-4-3-5-20(21)27-24(28)16-34-22-12-7-17(15-23(22)31-2)25(29)33-14-13-32-19-10-8-18(26)9-11-19/h3-12,15H,13-14,16H2,1-2H3,(H,27,28) |
| InChIKey | YBYGTOBVGOHZKR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.92 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|