C26H27NO8 — CID 25441229
2-(4-methoxyphenoxy)ethyl 3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoate (PubChem CID 25441229) has the molecular formula C26H27NO8 and a molecular weight of 481.50 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)ethyl 3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoate.
| Compound Name | 2-(4-methoxyphenoxy)ethyl 3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 25441229 |
| Molecular Formula | C26H27NO8 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 2-(4-methoxyphenoxy)ethyl 3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoate |
| SMILES | COc1ccc(OCCOC(=O)c2ccc(OCC(=O)Nc3ccccc3OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C26H27NO8/c1-30-19-9-11-20(12-10-19)33-14-15-34-26(29)18-8-13-23(24(16-18)32-3)35-17-25(28)27-21-6-4-5-7-22(21)31-2/h4-13,16H,14-15,17H2,1-3H3,(H,27,28) |
| InChIKey | VUCPJVDUIUZAAP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|