C19H21NO7 — CID 32697010
2-hydroxyethyl 3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoate (PubChem CID 32697010) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is 2-hydroxyethyl 3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoate.
| Compound Name | 2-hydroxyethyl 3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 32697010 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-hydroxyethyl 3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]benzoate |
| SMILES | COc1ccccc1NC(=O)COc1ccc(C(=O)OCCO)cc1OC |
| InChI | InChI=1S/C19H21NO7/c1-24-15-6-4-3-5-14(15)20-18(22)12-27-16-8-7-13(11-17(16)25-2)19(23)26-10-9-21/h3-8,11,21H,9-10,12H2,1-2H3,(H,20,22) |
| InChIKey | YAAJBXVJSUWQPM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |