C20H26N4O6S — CID 55321609
[2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate (PubChem CID 55321609) has the molecular formula C20H26N4O6S and a molecular weight of 450.52 g/mol. Its IUPAC name is [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate.
| Compound Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 55321609 |
| Molecular Formula | C20H26N4O6S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)N(CCC#N)CCC#N)cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C20H26N4O6S/c1-20(2,3)23-31(27,28)17-13-15(7-8-16(17)29-4)19(26)30-14-18(25)24(11-5-9-21)12-6-10-22/h7-8,13,23H,5-6,11-12,14H2,1-4H3 |
| InChIKey | GMNJLVFZHNKUSR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 149.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |