C17H25NO7S — CID 46544375
(2-oxo-2-propan-2-yloxyethyl) 3-(tert-butylsulfamoyl)-4-methoxybenzoate (PubChem CID 46544375) has the molecular formula C17H25NO7S and a molecular weight of 387.45 g/mol. Its IUPAC name is (2-oxo-2-propan-2-yloxyethyl) 3-(tert-butylsulfamoyl)-4-methoxybenzoate.
| Compound Name | (2-oxo-2-propan-2-yloxyethyl) 3-(tert-butylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 46544375 |
| Molecular Formula | C17H25NO7S |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | (2-oxo-2-propan-2-yloxyethyl) 3-(tert-butylsulfamoyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)OC(C)C)cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H25NO7S/c1-11(2)25-15(19)10-24-16(20)12-7-8-13(23-6)14(9-12)26(21,22)18-17(3,4)5/h7-9,11,18H,10H2,1-6H3 |
| InChIKey | JNWJHAKHNSHQDQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |