C17H25NO8S — CID 43050866
[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 4-methoxy-3-(2-methoxyethylsulfamoyl)benzoate (PubChem CID 43050866) has the molecular formula C17H25NO8S and a molecular weight of 403.45 g/mol. Its IUPAC name is [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 4-methoxy-3-(2-methoxyethylsulfamoyl)benzoate.
| Compound Name | [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 4-methoxy-3-(2-methoxyethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 43050866 |
| Molecular Formula | C17H25NO8S |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 4-methoxy-3-(2-methoxyethylsulfamoyl)benzoate |
| SMILES | COCCNS(=O)(=O)c1cc(C(=O)OCC(=O)OC(C)(C)C)ccc1OC |
| InChI | InChI=1S/C17H25NO8S/c1-17(2,3)26-15(19)11-25-16(20)12-6-7-13(24-5)14(10-12)27(21,22)18-8-9-23-4/h6-7,10,18H,8-9,11H2,1-5H3 |
| InChIKey | AGOLESBMFGUYIY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|