C20H25N3O7S — CID 24538797
2-methoxy-N-(2-methoxyethyl)-5-[[[2-(3-methylphenoxy)acetyl]amino]carbamoyl]benzenesulfonamide (PubChem CID 24538797) has the molecular formula C20H25N3O7S and a molecular weight of 451.50 g/mol. Its IUPAC name is 2-methoxy-N-(2-methoxyethyl)-5-[[[2-(3-methylphenoxy)acetyl]amino]carbamoyl]benzenesulfonamide.
| Compound Name | 2-methoxy-N-(2-methoxyethyl)-5-[[[2-(3-methylphenoxy)acetyl]amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24538797 |
| Molecular Formula | C20H25N3O7S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 2-methoxy-N-(2-methoxyethyl)-5-[[[2-(3-methylphenoxy)acetyl]amino]carbamoyl]benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1cc(C(=O)NNC(=O)COc2cccc(C)c2)ccc1OC |
| InChI | InChI=1S/C20H25N3O7S/c1-14-5-4-6-16(11-14)30-13-19(24)22-23-20(25)15-7-8-17(29-3)18(12-15)31(26,27)21-9-10-28-2/h4-8,11-12,21H,9-10,13H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | RRRRPSZGXKTBGP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|