C20H22N2O5 — CID 24538794
3-methoxy-N'-[2-(3-methylphenoxy)acetyl]-4-prop-2-enoxybenzohydrazide (PubChem CID 24538794) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 3-methoxy-N'-[2-(3-methylphenoxy)acetyl]-4-prop-2-enoxybenzohydrazide.
| Compound Name | 3-methoxy-N'-[2-(3-methylphenoxy)acetyl]-4-prop-2-enoxybenzohydrazide |
|---|---|
| PubChem CID | 24538794 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 3-methoxy-N'-[2-(3-methylphenoxy)acetyl]-4-prop-2-enoxybenzohydrazide |
| SMILES | C=CCOc1ccc(C(=O)NNC(=O)COc2cccc(C)c2)cc1OC |
| InChI | InChI=1S/C20H22N2O5/c1-4-10-26-17-9-8-15(12-18(17)25-3)20(24)22-21-19(23)13-27-16-7-5-6-14(2)11-16/h4-9,11-12H,1,10,13H2,2-3H3,(H,21,23)(H,22,24) |
| InChIKey | PRVLYDVMPYKBCF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|