C16H17N3O4 — CID 78829676
N'-(3-methoxy-4-prop-2-enoxybenzoyl)-1H-pyrrole-2-carbohydrazide (PubChem CID 78829676) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is N'-(3-methoxy-4-prop-2-enoxybenzoyl)-1H-pyrrole-2-carbohydrazide.
| Compound Name | N'-(3-methoxy-4-prop-2-enoxybenzoyl)-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 78829676 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N'-(3-methoxy-4-prop-2-enoxybenzoyl)-1H-pyrrole-2-carbohydrazide |
| SMILES | C=CCOc1ccc(C(=O)NNC(=O)c2ccc[nH]2)cc1OC |
| InChI | InChI=1S/C16H17N3O4/c1-3-9-23-13-7-6-11(10-14(13)22-2)15(20)18-19-16(21)12-5-4-8-17-12/h3-8,10,17H,1,9H2,2H3,(H,18,20)(H,19,21) |
| InChIKey | ZURHYNTVIXWOKS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|