C21H24ClN3O6S — CID 55350687
2-chloro-5-[[[2-(3-methylphenoxy)acetyl]amino]carbamoyl]-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 55350687) has the molecular formula C21H24ClN3O6S and a molecular weight of 481.96 g/mol. Its IUPAC name is 2-chloro-5-[[[2-(3-methylphenoxy)acetyl]amino]carbamoyl]-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 2-chloro-5-[[[2-(3-methylphenoxy)acetyl]amino]carbamoyl]-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55350687 |
| Molecular Formula | C21H24ClN3O6S |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 2-chloro-5-[[[2-(3-methylphenoxy)acetyl]amino]carbamoyl]-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | Cc1cccc(OCC(=O)NNC(=O)c2ccc(Cl)c(S(=O)(=O)NCC3CCCO3)c2)c1 |
| InChI | InChI=1S/C21H24ClN3O6S/c1-14-4-2-5-16(10-14)31-13-20(26)24-25-21(27)15-7-8-18(22)19(11-15)32(28,29)23-12-17-6-3-9-30-17/h2,4-5,7-8,10-11,17,23H,3,6,9,12-13H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | JDWDUCFTADYTEL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|