C18H18ClFN2O4S — CID 8017104
4-chloro-N-(3-fluorophenyl)-3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide (PubChem CID 8017104) has the molecular formula C18H18ClFN2O4S and a molecular weight of 412.87 g/mol. Its IUPAC name is 4-chloro-N-(3-fluorophenyl)-3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide.
| Compound Name | 4-chloro-N-(3-fluorophenyl)-3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 8017104 |
| Molecular Formula | C18H18ClFN2O4S |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 4-chloro-N-(3-fluorophenyl)-3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide |
| SMILES | O=C(Nc1cccc(F)c1)c1ccc(Cl)c(S(=O)(=O)NC[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C18H18ClFN2O4S/c19-16-7-6-12(18(23)22-14-4-1-3-13(20)10-14)9-17(16)27(24,25)21-11-15-5-2-8-26-15/h1,3-4,6-7,9-10,15,21H,2,5,8,11H2,(H,22,23)/t15-/m0/s1 |
| InChIKey | SEYKVMBKEMGCFJ-HNNXBMFYSA-N |
| XLogP | 3.19 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |