C15H16ClN3O4S2 — CID 18291900
4-chloro-3-(oxolan-2-ylmethylsulfamoyl)-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 18291900) has the molecular formula C15H16ClN3O4S2 and a molecular weight of 401.90 g/mol. Its IUPAC name is 4-chloro-3-(oxolan-2-ylmethylsulfamoyl)-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-chloro-3-(oxolan-2-ylmethylsulfamoyl)-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 18291900 |
| Molecular Formula | C15H16ClN3O4S2 |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 4-chloro-3-(oxolan-2-ylmethylsulfamoyl)-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nccs1)c1ccc(Cl)c(S(=O)(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C15H16ClN3O4S2/c16-12-4-3-10(14(20)19-15-17-5-7-24-15)8-13(12)25(21,22)18-9-11-2-1-6-23-11/h3-5,7-8,11,18H,1-2,6,9H2,(H,17,19,20) |
| InChIKey | XJGKKYFZVSNYRC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |