C20H23ClN2O4S — CID 9342591
4-chloro-N-(2,4-dimethylphenyl)-3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide (PubChem CID 9342591) has the molecular formula C20H23ClN2O4S and a molecular weight of 422.93 g/mol. Its IUPAC name is 4-chloro-N-(2,4-dimethylphenyl)-3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide.
| Compound Name | 4-chloro-N-(2,4-dimethylphenyl)-3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 9342591 |
| Molecular Formula | C20H23ClN2O4S |
| Molecular Weight | 422.93 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 4-chloro-N-(2,4-dimethylphenyl)-3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(Cl)c(S(=O)(=O)NC[C@@H]3CCCO3)c2)c(C)c1 |
| InChI | InChI=1S/C20H23ClN2O4S/c1-13-5-8-18(14(2)10-13)23-20(24)15-6-7-17(21)19(11-15)28(25,26)22-12-16-4-3-9-27-16/h5-8,10-11,16,22H,3-4,9,12H2,1-2H3,(H,23,24)/t16-/m0/s1 |
| InChIKey | NYWYQDUNSXZWFN-INIZCTEOSA-N |
| XLogP | 3.67 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.93 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |