C22H27ClN2O4S — CID 55349787
4-chloro-N-[1-(2,5-dimethylphenyl)ethyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide (PubChem CID 55349787) has the molecular formula C22H27ClN2O4S and a molecular weight of 450.99 g/mol. Its IUPAC name is 4-chloro-N-[1-(2,5-dimethylphenyl)ethyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | 4-chloro-N-[1-(2,5-dimethylphenyl)ethyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55349787 |
| Molecular Formula | C22H27ClN2O4S |
| Molecular Weight | 450.99 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 4-chloro-N-[1-(2,5-dimethylphenyl)ethyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide |
| SMILES | Cc1ccc(C)c(C(C)NC(=O)c2ccc(Cl)c(S(=O)(=O)NCC3CCCO3)c2)c1 |
| InChI | InChI=1S/C22H27ClN2O4S/c1-14-6-7-15(2)19(11-14)16(3)25-22(26)17-8-9-20(23)21(12-17)30(27,28)24-13-18-5-4-10-29-18/h6-9,11-12,16,18,24H,4-5,10,13H2,1-3H3,(H,25,26) |
| InChIKey | VPKFYFSHFVGRRB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.99 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |