C20H23ClN2O4S — CID 9473645
4-chloro-N-[(4-methylphenyl)methyl]-3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide (PubChem CID 9473645) has the molecular formula C20H23ClN2O4S and a molecular weight of 422.93 g/mol. Its IUPAC name is 4-chloro-N-[(4-methylphenyl)methyl]-3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide.
| Compound Name | 4-chloro-N-[(4-methylphenyl)methyl]-3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 9473645 |
| Molecular Formula | C20H23ClN2O4S |
| Molecular Weight | 422.93 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 4-chloro-N-[(4-methylphenyl)methyl]-3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide |
| SMILES | Cc1ccc(CNC(=O)c2ccc(Cl)c(S(=O)(=O)NC[C@@H]3CCCO3)c2)cc1 |
| InChI | InChI=1S/C20H23ClN2O4S/c1-14-4-6-15(7-5-14)12-22-20(24)16-8-9-18(21)19(11-16)28(25,26)23-13-17-3-2-10-27-17/h4-9,11,17,23H,2-3,10,12-13H2,1H3,(H,22,24)/t17-/m0/s1 |
| InChIKey | XJXDRGDFHXJSKR-KRWDZBQOSA-N |
| XLogP | 3.04 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.93 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |