C20H23ClN2O5S — CID 46799138
4-chloro-N-[(3-methoxyphenyl)methyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide (PubChem CID 46799138) has the molecular formula C20H23ClN2O5S and a molecular weight of 438.93 g/mol. Its IUPAC name is 4-chloro-N-[(3-methoxyphenyl)methyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | 4-chloro-N-[(3-methoxyphenyl)methyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 46799138 |
| Molecular Formula | C20H23ClN2O5S |
| Molecular Weight | 438.93 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 4-chloro-N-[(3-methoxyphenyl)methyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide |
| SMILES | COc1cccc(CNC(=O)c2ccc(Cl)c(S(=O)(=O)NCC3CCCO3)c2)c1 |
| InChI | InChI=1S/C20H23ClN2O5S/c1-27-16-5-2-4-14(10-16)12-22-20(24)15-7-8-18(21)19(11-15)29(25,26)23-13-17-6-3-9-28-17/h2,4-5,7-8,10-11,17,23H,3,6,9,12-13H2,1H3,(H,22,24) |
| InChIKey | DXAXEZLHHOAZML-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.93 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |