C17H23ClN2O6S — CID 56547063
propan-2-yl 2-[[4-chloro-3-(oxolan-2-ylmethylsulfamoyl)benzoyl]amino]acetate (PubChem CID 56547063) has the molecular formula C17H23ClN2O6S and a molecular weight of 418.90 g/mol. Its IUPAC name is propan-2-yl 2-[[4-chloro-3-(oxolan-2-ylmethylsulfamoyl)benzoyl]amino]acetate.
| Compound Name | propan-2-yl 2-[[4-chloro-3-(oxolan-2-ylmethylsulfamoyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 56547063 |
| Molecular Formula | C17H23ClN2O6S |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | propan-2-yl 2-[[4-chloro-3-(oxolan-2-ylmethylsulfamoyl)benzoyl]amino]acetate |
| SMILES | CC(C)OC(=O)CNC(=O)c1ccc(Cl)c(S(=O)(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C17H23ClN2O6S/c1-11(2)26-16(21)10-19-17(22)12-5-6-14(18)15(8-12)27(23,24)20-9-13-4-3-7-25-13/h5-6,8,11,13,20H,3-4,7,9-10H2,1-2H3,(H,19,22) |
| InChIKey | PZDJKASEJOMCII-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |