C23H29ClN4O4S — CID 55541273
4-chloro-N-[2-(4-methylpiperazin-1-yl)phenyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide (PubChem CID 55541273) has the molecular formula C23H29ClN4O4S and a molecular weight of 493.03 g/mol. Its IUPAC name is 4-chloro-N-[2-(4-methylpiperazin-1-yl)phenyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | 4-chloro-N-[2-(4-methylpiperazin-1-yl)phenyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55541273 |
| Molecular Formula | C23H29ClN4O4S |
| Molecular Weight | 493.03 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 4-chloro-N-[2-(4-methylpiperazin-1-yl)phenyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide |
| SMILES | CN1CCN(c2ccccc2NC(=O)c2ccc(Cl)c(S(=O)(=O)NCC3CCCO3)c2)CC1 |
| InChI | InChI=1S/C23H29ClN4O4S/c1-27-10-12-28(13-11-27)21-7-3-2-6-20(21)26-23(29)17-8-9-19(24)22(15-17)33(30,31)25-16-18-5-4-14-32-18/h2-3,6-9,15,18,25H,4-5,10-14,16H2,1H3,(H,26,29) |
| InChIKey | XXKUWMVIVRUZEO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.03 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |