C19H24ClF3N2O4S — CID 55546561
4-chloro-3-(oxolan-2-ylmethylsulfamoyl)-N-[2-(trifluoromethyl)cyclohexyl]benzamide (PubChem CID 55546561) has the molecular formula C19H24ClF3N2O4S and a molecular weight of 468.93 g/mol. Its IUPAC name is 4-chloro-3-(oxolan-2-ylmethylsulfamoyl)-N-[2-(trifluoromethyl)cyclohexyl]benzamide.
| Compound Name | 4-chloro-3-(oxolan-2-ylmethylsulfamoyl)-N-[2-(trifluoromethyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 55546561 |
| Molecular Formula | C19H24ClF3N2O4S |
| Molecular Weight | 468.93 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 4-chloro-3-(oxolan-2-ylmethylsulfamoyl)-N-[2-(trifluoromethyl)cyclohexyl]benzamide |
| SMILES | O=C(NC1CCCCC1C(F)(F)F)c1ccc(Cl)c(S(=O)(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C19H24ClF3N2O4S/c20-15-8-7-12(10-17(15)30(27,28)24-11-13-4-3-9-29-13)18(26)25-16-6-2-1-5-14(16)19(21,22)23/h7-8,10,13-14,16,24H,1-6,9,11H2,(H,25,26) |
| InChIKey | DHXSMDPYSAEWAE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.93 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |