C19H23N3O6S — CID 27598810
5-[[[2-(3,4-dimethylphenoxy)acetyl]amino]carbamoyl]-2-methoxy-N-methylbenzenesulfonamide (PubChem CID 27598810) has the molecular formula C19H23N3O6S and a molecular weight of 421.48 g/mol. Its IUPAC name is 5-[[[2-(3,4-dimethylphenoxy)acetyl]amino]carbamoyl]-2-methoxy-N-methylbenzenesulfonamide.
| Compound Name | 5-[[[2-(3,4-dimethylphenoxy)acetyl]amino]carbamoyl]-2-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 27598810 |
| Molecular Formula | C19H23N3O6S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 5-[[[2-(3,4-dimethylphenoxy)acetyl]amino]carbamoyl]-2-methoxy-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)NNC(=O)COc2ccc(C)c(C)c2)ccc1OC |
| InChI | InChI=1S/C19H23N3O6S/c1-12-5-7-15(9-13(12)2)28-11-18(23)21-22-19(24)14-6-8-16(27-4)17(10-14)29(25,26)20-3/h5-10,20H,11H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | LHDZYMFYIYTAOW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|