C25H27N3O6S — CID 24661370
4-[[[2-(3,4-dimethylphenoxy)acetyl]amino]carbamoyl]-N-(2-methoxyphenyl)-N-methylbenzenesulfonamide (PubChem CID 24661370) has the molecular formula C25H27N3O6S and a molecular weight of 497.57 g/mol. Its IUPAC name is 4-[[[2-(3,4-dimethylphenoxy)acetyl]amino]carbamoyl]-N-(2-methoxyphenyl)-N-methylbenzenesulfonamide.
| Compound Name | 4-[[[2-(3,4-dimethylphenoxy)acetyl]amino]carbamoyl]-N-(2-methoxyphenyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 24661370 |
| Molecular Formula | C25H27N3O6S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 4-[[[2-(3,4-dimethylphenoxy)acetyl]amino]carbamoyl]-N-(2-methoxyphenyl)-N-methylbenzenesulfonamide |
| SMILES | COc1ccccc1N(C)S(=O)(=O)c1ccc(C(=O)NNC(=O)COc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C25H27N3O6S/c1-17-9-12-20(15-18(17)2)34-16-24(29)26-27-25(30)19-10-13-21(14-11-19)35(31,32)28(3)22-7-5-6-8-23(22)33-4/h5-15H,16H2,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | YNWBDWOKGDCADX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|