C21H28N2O4S — CID 8886328
N-hexyl-4-[(2-methoxyphenyl)-methylsulfamoyl]benzamide (PubChem CID 8886328) has the molecular formula C21H28N2O4S and a molecular weight of 404.53 g/mol. Its IUPAC name is N-hexyl-4-[(2-methoxyphenyl)-methylsulfamoyl]benzamide.
| Compound Name | N-hexyl-4-[(2-methoxyphenyl)-methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 8886328 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-hexyl-4-[(2-methoxyphenyl)-methylsulfamoyl]benzamide |
| SMILES | CCCCCCNC(=O)c1ccc(S(=O)(=O)N(C)c2ccccc2OC)cc1 |
| InChI | InChI=1S/C21H28N2O4S/c1-4-5-6-9-16-22-21(24)17-12-14-18(15-13-17)28(25,26)23(2)19-10-7-8-11-20(19)27-3/h7-8,10-15H,4-6,9,16H2,1-3H3,(H,22,24) |
| InChIKey | ITFGQQOLJKVTSM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|