C21H25NO7S — CID 16569078
(2-butoxy-2-oxoethyl) 4-[(2-methoxyphenyl)-methylsulfamoyl]benzoate (PubChem CID 16569078) has the molecular formula C21H25NO7S and a molecular weight of 435.50 g/mol. Its IUPAC name is (2-butoxy-2-oxoethyl) 4-[(2-methoxyphenyl)-methylsulfamoyl]benzoate.
| Compound Name | (2-butoxy-2-oxoethyl) 4-[(2-methoxyphenyl)-methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 16569078 |
| Molecular Formula | C21H25NO7S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | (2-butoxy-2-oxoethyl) 4-[(2-methoxyphenyl)-methylsulfamoyl]benzoate |
| SMILES | CCCCOC(=O)COC(=O)c1ccc(S(=O)(=O)N(C)c2ccccc2OC)cc1 |
| InChI | InChI=1S/C21H25NO7S/c1-4-5-14-28-20(23)15-29-21(24)16-10-12-17(13-11-16)30(25,26)22(2)18-8-6-7-9-19(18)27-3/h6-13H,4-5,14-15H2,1-3H3 |
| InChIKey | BMGMZJLZDBUEFD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|