C18H21NO5S — CID 43004476
propan-2-yl 4-[(2-methoxyphenyl)-methylsulfamoyl]benzoate (PubChem CID 43004476) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is propan-2-yl 4-[(2-methoxyphenyl)-methylsulfamoyl]benzoate.
| Compound Name | propan-2-yl 4-[(2-methoxyphenyl)-methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 43004476 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | propan-2-yl 4-[(2-methoxyphenyl)-methylsulfamoyl]benzoate |
| SMILES | COc1ccccc1N(C)S(=O)(=O)c1ccc(C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C18H21NO5S/c1-13(2)24-18(20)14-9-11-15(12-10-14)25(21,22)19(3)16-7-5-6-8-17(16)23-4/h5-13H,1-4H3 |
| InChIKey | VVMJSCTXPVWFIX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |