C29H25NO6S — CID 4599949
(2-oxo-1,2-diphenylethyl) 4-[(2-methoxyphenyl)-methylsulfamoyl]benzoate (PubChem CID 4599949) has the molecular formula C29H25NO6S and a molecular weight of 515.59 g/mol. Its IUPAC name is (2-oxo-1,2-diphenylethyl) 4-[(2-methoxyphenyl)-methylsulfamoyl]benzoate.
| Compound Name | (2-oxo-1,2-diphenylethyl) 4-[(2-methoxyphenyl)-methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 4599949 |
| Molecular Formula | C29H25NO6S |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | (2-oxo-1,2-diphenylethyl) 4-[(2-methoxyphenyl)-methylsulfamoyl]benzoate |
| SMILES | COc1ccccc1N(C)S(=O)(=O)c1ccc(C(=O)OC(C(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H25NO6S/c1-30(25-15-9-10-16-26(25)35-2)37(33,34)24-19-17-23(18-20-24)29(32)36-28(22-13-7-4-8-14-22)27(31)21-11-5-3-6-12-21/h3-20,28H,1-2H3 |
| InChIKey | YQYUFQGSYVTWLI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |