C25H24N2O7S — CID 55317196
[2-(3-acetylanilino)-2-oxoethyl] 4-[(2-methoxyphenyl)-methylsulfamoyl]benzoate (PubChem CID 55317196) has the molecular formula C25H24N2O7S and a molecular weight of 496.54 g/mol. Its IUPAC name is [2-(3-acetylanilino)-2-oxoethyl] 4-[(2-methoxyphenyl)-methylsulfamoyl]benzoate.
| Compound Name | [2-(3-acetylanilino)-2-oxoethyl] 4-[(2-methoxyphenyl)-methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 55317196 |
| Molecular Formula | C25H24N2O7S |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | [2-(3-acetylanilino)-2-oxoethyl] 4-[(2-methoxyphenyl)-methylsulfamoyl]benzoate |
| SMILES | COc1ccccc1N(C)S(=O)(=O)c1ccc(C(=O)OCC(=O)Nc2cccc(C(C)=O)c2)cc1 |
| InChI | InChI=1S/C25H24N2O7S/c1-17(28)19-7-6-8-20(15-19)26-24(29)16-34-25(30)18-11-13-21(14-12-18)35(31,32)27(2)22-9-4-5-10-23(22)33-3/h4-15H,16H2,1-3H3,(H,26,29) |
| InChIKey | YNXSTRNEFOPVAJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |