C24H31N3O5S — CID 27598657
N-cyclohexyl-4-[[[2-(3,4-dimethylphenoxy)acetyl]amino]carbamoyl]-N-methylbenzenesulfonamide (PubChem CID 27598657) has the molecular formula C24H31N3O5S and a molecular weight of 473.60 g/mol. Its IUPAC name is N-cyclohexyl-4-[[[2-(3,4-dimethylphenoxy)acetyl]amino]carbamoyl]-N-methylbenzenesulfonamide.
| Compound Name | N-cyclohexyl-4-[[[2-(3,4-dimethylphenoxy)acetyl]amino]carbamoyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 27598657 |
| Molecular Formula | C24H31N3O5S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | N-cyclohexyl-4-[[[2-(3,4-dimethylphenoxy)acetyl]amino]carbamoyl]-N-methylbenzenesulfonamide |
| SMILES | Cc1ccc(OCC(=O)NNC(=O)c2ccc(S(=O)(=O)N(C)C3CCCCC3)cc2)cc1C |
| InChI | InChI=1S/C24H31N3O5S/c1-17-9-12-21(15-18(17)2)32-16-23(28)25-26-24(29)19-10-13-22(14-11-19)33(30,31)27(3)20-7-5-4-6-8-20/h9-15,20H,4-8,16H2,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | FRJOHRLBYWILKQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|