C22H28N2O7S — CID 42987867
[2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 4-methoxy-3-(2-methoxyethylsulfamoyl)benzoate (PubChem CID 42987867) has the molecular formula C22H28N2O7S and a molecular weight of 464.54 g/mol. Its IUPAC name is [2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 4-methoxy-3-(2-methoxyethylsulfamoyl)benzoate.
| Compound Name | [2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 4-methoxy-3-(2-methoxyethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 42987867 |
| Molecular Formula | C22H28N2O7S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | [2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 4-methoxy-3-(2-methoxyethylsulfamoyl)benzoate |
| SMILES | COCCNS(=O)(=O)c1cc(C(=O)OCC(=O)c2cc(C)n(C3CC3)c2C)ccc1OC |
| InChI | InChI=1S/C22H28N2O7S/c1-14-11-18(15(2)24(14)17-6-7-17)19(25)13-31-22(26)16-5-8-20(30-4)21(12-16)32(27,28)23-9-10-29-3/h5,8,11-12,17,23H,6-7,9-10,13H2,1-4H3 |
| InChIKey | OXLBNCZHNDUUGJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|