C21H25NO6S2 — CID 46792069
[2-(4-methylsulfanylphenyl)-2-oxoethyl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate (PubChem CID 46792069) has the molecular formula C21H25NO6S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is [2-(4-methylsulfanylphenyl)-2-oxoethyl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate.
| Compound Name | [2-(4-methylsulfanylphenyl)-2-oxoethyl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 46792069 |
| Molecular Formula | C21H25NO6S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | [2-(4-methylsulfanylphenyl)-2-oxoethyl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)c2ccc(SC)cc2)cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C21H25NO6S2/c1-21(2,3)22-30(25,26)19-12-15(8-11-18(19)27-4)20(24)28-13-17(23)14-6-9-16(29-5)10-7-14/h6-12,22H,13H2,1-5H3 |
| InChIKey | CLCGNMLOIJGZTP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |