C18H28N2O6S — CID 46811348
[1-oxo-1-(propan-2-ylamino)propan-2-yl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate (PubChem CID 46811348) has the molecular formula C18H28N2O6S and a molecular weight of 400.50 g/mol. Its IUPAC name is [1-oxo-1-(propan-2-ylamino)propan-2-yl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate.
| Compound Name | [1-oxo-1-(propan-2-ylamino)propan-2-yl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 46811348 |
| Molecular Formula | C18H28N2O6S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [1-oxo-1-(propan-2-ylamino)propan-2-yl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OC(C)C(=O)NC(C)C)cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H28N2O6S/c1-11(2)19-16(21)12(3)26-17(22)13-8-9-14(25-7)15(10-13)27(23,24)20-18(4,5)6/h8-12,20H,1-7H3,(H,19,21) |
| InChIKey | KEKXIVWTETXNNL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |