C26H28N2O6S — CID 42986774
[1-oxo-1-(2-phenylanilino)propan-2-yl] 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate (PubChem CID 42986774) has the molecular formula C26H28N2O6S and a molecular weight of 496.59 g/mol. Its IUPAC name is [1-oxo-1-(2-phenylanilino)propan-2-yl] 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate.
| Compound Name | [1-oxo-1-(2-phenylanilino)propan-2-yl] 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 42986774 |
| Molecular Formula | C26H28N2O6S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | [1-oxo-1-(2-phenylanilino)propan-2-yl] 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate |
| SMILES | COc1ccc(C(=O)OC(C)C(=O)Nc2ccccc2-c2ccccc2)cc1S(=O)(=O)NC(C)C |
| InChI | InChI=1S/C26H28N2O6S/c1-17(2)28-35(31,32)24-16-20(14-15-23(24)33-4)26(30)34-18(3)25(29)27-22-13-9-8-12-21(22)19-10-6-5-7-11-19/h5-18,28H,1-4H3,(H,27,29) |
| InChIKey | GJCQQNJKSCJWJT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |